C23H26ClNO4 — CID 11582420
2-[3-[1-[2-(3-chlorophenyl)acetyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid (PubChem CID 11582420) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-[3-[1-[2-(3-chlorophenyl)acetyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[1-[2-(3-chlorophenyl)acetyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11582420 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-[3-[1-[2-(3-chlorophenyl)acetyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cccc(C2CCCN(C(=O)Cc3cccc(Cl)c3)C2)c1)C(=O)O |
| InChI | InChI=1S/C23H26ClNO4/c1-23(2,22(27)28)29-20-10-4-7-17(14-20)18-8-5-11-25(15-18)21(26)13-16-6-3-9-19(24)12-16/h3-4,6-7,9-10,12,14,18H,5,8,11,13,15H2,1-2H3,(H,27,28) |
| InChIKey | HKEJATXHOBFSSK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |