C28H32BrNO2 — CID 68782691
tert-butyl N-[3-(3-bromophenyl)cyclopentyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate (PubChem CID 68782691) has the molecular formula C28H32BrNO2 and a molecular weight of 494.47 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromophenyl)cyclopentyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromophenyl)cyclopentyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
|---|---|
| PubChem CID | 68782691 |
| Molecular Formula | C28H32BrNO2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | tert-butyl N-[3-(3-bromophenyl)cyclopentyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
| SMILES | C[C@H](c1cccc2ccccc12)N(C(=O)OC(C)(C)C)C1CCC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C28H32BrNO2/c1-19(25-14-8-10-20-9-5-6-13-26(20)25)30(27(31)32-28(2,3)4)24-16-15-22(18-24)21-11-7-12-23(29)17-21/h5-14,17,19,22,24H,15-16,18H2,1-4H3/t19-,22?,24?/m1/s1 |
| InChIKey | URVRIHCBGMUEBK-BJRAERQBSA-N |
| XLogP | 8.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |