C29H36N2O2 — CID 91529598
tert-butyl N-[(4-benzylpyrrolidin-3-yl)methyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate (PubChem CID 91529598) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl N-[(4-benzylpyrrolidin-3-yl)methyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(4-benzylpyrrolidin-3-yl)methyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
|---|---|
| PubChem CID | 91529598 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl N-[(4-benzylpyrrolidin-3-yl)methyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
| SMILES | C[C@H](c1cccc2ccccc12)N(CC1CNCC1Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H36N2O2/c1-21(26-16-10-14-23-13-8-9-15-27(23)26)31(28(32)33-29(2,3)4)20-25-19-30-18-24(25)17-22-11-6-5-7-12-22/h5-16,21,24-25,30H,17-20H2,1-4H3/t21-,24?,25?/m1/s1 |
| InChIKey | MGXBVMVZYLBYEM-BURHJUHKSA-N |
| XLogP | 6.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |