C27H33NO2 — CID 58351223
tert-butyl N-[3-(3-methylphenyl)propyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate (PubChem CID 58351223) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl N-[3-(3-methylphenyl)propyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-methylphenyl)propyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
|---|---|
| PubChem CID | 58351223 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl N-[3-(3-methylphenyl)propyl]-N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
| SMILES | Cc1cccc(CCCN(C(=O)OC(C)(C)C)[C@H](C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C27H33NO2/c1-20-11-8-12-22(19-20)13-10-18-28(26(29)30-27(3,4)5)21(2)24-17-9-15-23-14-6-7-16-25(23)24/h6-9,11-12,14-17,19,21H,10,13,18H2,1-5H3/t21-/m1/s1 |
| InChIKey | SWAMUFZMAJTAKQ-OAQYLSRUSA-N |
| XLogP | 7.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |