C22H22F3NS — CID 174834815
N-(1-naphthalen-1-ylethyl)-N-[3-[3-(trifluoromethyl)phenyl]propyl]thiohydroxylamine (PubChem CID 174834815) has the molecular formula C22H22F3NS and a molecular weight of 389.49 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-N-[3-[3-(trifluoromethyl)phenyl]propyl]thiohydroxylamine.
| Compound Name | N-(1-naphthalen-1-ylethyl)-N-[3-[3-(trifluoromethyl)phenyl]propyl]thiohydroxylamine |
|---|---|
| PubChem CID | 174834815 |
| Molecular Formula | C22H22F3NS |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-N-[3-[3-(trifluoromethyl)phenyl]propyl]thiohydroxylamine |
| SMILES | CC(c1cccc2ccccc12)N(S)CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3NS/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26(27)14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,27H,6,8,14H2,1H3 |
| InChIKey | SCYXEVBTPABUAW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|