C21H19F3NO- — CID 87397781
N-(naphthalen-1-ylmethyl)-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 87397781) has the molecular formula C21H19F3NO- and a molecular weight of 358.38 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-(naphthalen-1-ylmethyl)-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 87397781 |
| Molecular Formula | C21H19F3NO- |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(naphthalen-1-ylmethyl)-N-oxido-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | [O-]N(CCCc1cccc(C(F)(F)F)c1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H19F3NO/c22-21(23,24)19-11-3-6-16(14-19)7-5-13-25(26)15-18-10-4-9-17-8-1-2-12-20(17)18/h1-4,6,8-12,14H,5,7,13,15H2/q-1 |
| InChIKey | OJRVSYCRUMJEHA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|