C21H21F3NP — CID 123366588
N-(naphthalen-1-ylmethyl)-N-phosphanyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 123366588) has the molecular formula C21H21F3NP and a molecular weight of 375.37 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-N-phosphanyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-(naphthalen-1-ylmethyl)-N-phosphanyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 123366588 |
| Molecular Formula | C21H21F3NP |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(naphthalen-1-ylmethyl)-N-phosphanyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | FC(F)(F)c1cccc(CCCN(P)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H21F3NP/c22-21(23,24)19-11-3-6-16(14-19)7-5-13-25(26)15-18-10-4-9-17-8-1-2-12-20(17)18/h1-4,6,8-12,14H,5,7,13,15,26H2 |
| InChIKey | XUUFEEQZAUWQEP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|