C16H15F3O — CID 170887677
3-[3-[3-(trifluoromethyl)phenyl]phenyl]propan-1-ol (PubChem CID 170887677) has the molecular formula C16H15F3O and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-[3-[3-(trifluoromethyl)phenyl]phenyl]propan-1-ol.
| Compound Name | 3-[3-[3-(trifluoromethyl)phenyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 170887677 |
| Molecular Formula | C16H15F3O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[3-[3-(trifluoromethyl)phenyl]phenyl]propan-1-ol |
| SMILES | OCCCc1cccc(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3O/c17-16(18,19)15-8-2-7-14(11-15)13-6-1-4-12(10-13)5-3-9-20/h1-2,4,6-8,10-11,20H,3,5,9H2 |
| InChIKey | UWCGZVWABCONHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |