C17H17F3O2 — CID 15059584
3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol (PubChem CID 15059584) has the molecular formula C17H17F3O2 and a molecular weight of 310.31 g/mol. Its IUPAC name is 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol.
| Compound Name | 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 15059584 |
| Molecular Formula | C17H17F3O2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol |
| SMILES | OCCCc1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H17F3O2/c18-17(19,20)15-5-1-3-14(11-15)12-22-16-8-6-13(7-9-16)4-2-10-21/h1,3,5-9,11,21H,2,4,10,12H2 |
| InChIKey | YBVIQSRNZYTANQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |