C18H16F3NO3 — CID 59967532
(2E)-2-methoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-one (PubChem CID 59967532) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is (2E)-2-methoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-one.
| Compound Name | (2E)-2-methoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 59967532 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2E)-2-methoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-one |
| SMILES | CO/N=C(\C)C(=O)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F3NO3/c1-12(22-24-2)17(23)14-6-8-16(9-7-14)25-11-13-4-3-5-15(10-13)18(19,20)21/h3-10H,11H2,1-2H3/b22-12+ |
| InChIKey | YBOWQXRUAMJHDX-WSDLNYQXSA-N |
| XLogP | 4.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|