C17H19ClF3NO2 — CID 139814631
3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]propan-1-amine;hydrochloride (PubChem CID 139814631) has the molecular formula C17H19ClF3NO2 and a molecular weight of 361.79 g/mol. Its IUPAC name is 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]propan-1-amine;hydrochloride.
| Compound Name | 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 139814631 |
| Molecular Formula | C17H19ClF3NO2 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]propan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOc1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H18F3NO2.ClH/c18-17(19,20)14-4-1-3-13(11-14)12-23-16-7-5-15(6-8-16)22-10-2-9-21;/h1,3-8,11H,2,9-10,12,21H2;1H |
| InChIKey | SXOLBQDFXXCOGK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|