C17H17ClF3NO — CID 170867877
3-[5-chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-amine (PubChem CID 170867877) has the molecular formula C17H17ClF3NO and a molecular weight of 343.78 g/mol. Its IUPAC name is 3-[5-chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-amine.
| Compound Name | 3-[5-chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 170867877 |
| Molecular Formula | C17H17ClF3NO |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[5-chloro-2-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-amine |
| SMILES | NCCCc1cc(Cl)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17ClF3NO/c18-15-6-7-16(13(10-15)4-2-8-22)23-11-12-3-1-5-14(9-12)17(19,20)21/h1,3,5-7,9-10H,2,4,8,11,22H2 |
| InChIKey | XIPAGBARMVWSAH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |