C19H18F3NO3 — CID 141148449
prop-2-enyl N-methyl-N-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate (PubChem CID 141148449) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is prop-2-enyl N-methyl-N-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate.
| Compound Name | prop-2-enyl N-methyl-N-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 141148449 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | prop-2-enyl N-methyl-N-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate |
| SMILES | C=CCOC(=O)N(C)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F3NO3/c1-3-11-25-18(24)23(2)16-7-9-17(10-8-16)26-13-14-5-4-6-15(12-14)19(20,21)22/h3-10,12H,1,11,13H2,2H3 |
| InChIKey | FNGUVNRXVZAPPN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|