C20H23F3N2O2 — CID 166625545
2-methyl-2-[2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylamino]propanamide (PubChem CID 166625545) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-methyl-2-[2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylamino]propanamide.
| Compound Name | 2-methyl-2-[2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylamino]propanamide |
|---|---|
| PubChem CID | 166625545 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-methyl-2-[2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylamino]propanamide |
| SMILES | CC(C)(NCCc1ccc(OCc2cccc(C(F)(F)F)c2)cc1)C(N)=O |
| InChI | InChI=1S/C20H23F3N2O2/c1-19(2,18(24)26)25-11-10-14-6-8-17(9-7-14)27-13-15-4-3-5-16(12-15)20(21,22)23/h3-9,12,25H,10-11,13H2,1-2H3,(H2,24,26) |
| InChIKey | HEFHXOPQEMAVDB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |