C32H29F3N2O6 — CID 172938924
methyl 3-methoxy-2-[2-[[[(1E)-1-prop-2-ynoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-2-ylidene]amino]oxymethyl]phenyl]prop-2-enoate (PubChem CID 172938924) has the molecular formula C32H29F3N2O6 and a molecular weight of 594.59 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-[[[(1E)-1-prop-2-ynoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-2-ylidene]amino]oxymethyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-[[[(1E)-1-prop-2-ynoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-2-ylidene]amino]oxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 172938924 |
| Molecular Formula | C32H29F3N2O6 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | methyl 3-methoxy-2-[2-[[[(1E)-1-prop-2-ynoxyimino-1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]propan-2-ylidene]amino]oxymethyl]phenyl]prop-2-enoate |
| SMILES | C#CCO/N=C(/C(C)=NOCc1ccccc1C(=COC)C(=O)OC)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C32H29F3N2O6/c1-5-17-42-37-30(22(2)36-43-20-25-10-6-7-12-28(25)29(21-39-3)31(38)40-4)24-13-15-27(16-14-24)41-19-23-9-8-11-26(18-23)32(33,34)35/h1,6-16,18,21H,17,19-20H2,2-4H3/b29-21?,36-22?,37-30- |
| InChIKey | HWOVSFZPVNJHCQ-GLZPKLGESA-N |
| XLogP | 6.39 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|