C31H31F3N2O6 — CID 57159258
methyl 2-[2-[[[1-ethoxyimino-1-[4-[3-(trifluoromethyl)phenoxy]phenyl]but-2-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 57159258) has the molecular formula C31H31F3N2O6 and a molecular weight of 584.59 g/mol. Its IUPAC name is methyl 2-[2-[[[1-ethoxyimino-1-[4-[3-(trifluoromethyl)phenoxy]phenyl]but-2-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[[1-ethoxyimino-1-[4-[3-(trifluoromethyl)phenoxy]phenyl]but-2-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 57159258 |
| Molecular Formula | C31H31F3N2O6 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | methyl 2-[2-[[[1-ethoxyimino-1-[4-[3-(trifluoromethyl)phenoxy]phenyl]but-2-en-2-yl]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CC=C(NOCc1ccccc1C(=COC)C(=O)OC)C(=NOCC)c1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C31H31F3N2O6/c1-5-28(35-41-19-22-10-7-8-13-26(22)27(20-38-3)30(37)39-4)29(36-40-6-2)21-14-16-24(17-15-21)42-25-12-9-11-23(18-25)31(32,33)34/h5,7-18,20,35H,6,19H2,1-4H3 |
| InChIKey | XKKNNOJBOPWPSW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|