C29H24F3NO5S — CID 57319898
methyl 3-methoxy-2-[5-[[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethenylamino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate (PubChem CID 57319898) has the molecular formula C29H24F3NO5S and a molecular weight of 555.57 g/mol. Its IUPAC name is methyl 3-methoxy-2-[5-[[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethenylamino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[5-[[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethenylamino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57319898 |
| Molecular Formula | C29H24F3NO5S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | methyl 3-methoxy-2-[5-[[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethenylamino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate |
| SMILES | C=C(NOCc1ccc2scc(C(=COC)C(=O)OC)c2c1)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H24F3NO5S/c1-18(20-6-4-8-22(13-20)38-23-9-5-7-21(14-23)29(30,31)32)33-37-15-19-10-11-27-24(12-19)26(17-39-27)25(16-35-2)28(34)36-3/h4-14,16-17,33H,1,15H2,2-3H3 |
| InChIKey | JZKLTNSLUCKTBD-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|