C23H24N2O4S — CID 57168830
methyl 3-methoxy-2-[5-[[(2-methyl-1-pyridin-2-ylprop-1-enyl)amino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate (PubChem CID 57168830) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is methyl 3-methoxy-2-[5-[[(2-methyl-1-pyridin-2-ylprop-1-enyl)amino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[5-[[(2-methyl-1-pyridin-2-ylprop-1-enyl)amino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57168830 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | methyl 3-methoxy-2-[5-[[(2-methyl-1-pyridin-2-ylprop-1-enyl)amino]oxymethyl]-1-benzothiophen-3-yl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1csc2ccc(CONC(=C(C)C)c3ccccn3)cc12 |
| InChI | InChI=1S/C23H24N2O4S/c1-15(2)22(20-7-5-6-10-24-20)25-29-12-16-8-9-21-17(11-16)19(14-30-21)18(13-27-3)23(26)28-4/h5-11,13-14,25H,12H2,1-4H3 |
| InChIKey | ZVRXROSXQCFQTD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|