C23H28N2O5 — CID 139911240
methyl (E)-2-[2-[[(E)-C-ethyl-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 139911240) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl (E)-2-[2-[[(E)-C-ethyl-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[(E)-C-ethyl-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 139911240 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | methyl (E)-2-[2-[[(E)-C-ethyl-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CC/C(=N\OC(CC)c1ccccn1)OCc1ccccc1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H28N2O5/c1-5-21(20-13-9-10-14-24-20)30-25-22(6-2)29-15-17-11-7-8-12-18(17)19(16-27-3)23(26)28-4/h7-14,16,21H,5-6,15H2,1-4H3/b19-16+,25-22+ |
| InChIKey | LYYYYLVUZUTOJR-JFXZCAOVSA-N |
| XLogP | 4.65 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|