C23H26N2O5 — CID 57300838
2-[2-[C-(cyclopropylmethoxy)-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 57300838) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[2-[C-(cyclopropylmethoxy)-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-[C-(cyclopropylmethoxy)-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 57300838 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[2-[C-(cyclopropylmethoxy)-N-(1-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CCC(ON=C(OCC1CC1)c1ccccc1C(=COC)C(=O)O)c1ccccn1 |
| InChI | InChI=1S/C23H26N2O5/c1-3-21(20-10-6-7-13-24-20)30-25-22(29-14-16-11-12-16)18-9-5-4-8-17(18)19(15-28-2)23(26)27/h4-10,13,15-16,21H,3,11-12,14H2,1-2H3,(H,26,27) |
| InChIKey | XSTPKJYGORLGBS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|