C20H23NO3S — CID 67860679
3-methoxy-2-[2-[1-(2-pentan-2-yl-1,3-thiazol-4-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 67860679) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-methoxy-2-[2-[1-(2-pentan-2-yl-1,3-thiazol-4-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-methoxy-2-[2-[1-(2-pentan-2-yl-1,3-thiazol-4-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67860679 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-methoxy-2-[2-[1-(2-pentan-2-yl-1,3-thiazol-4-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | C=C(c1csc(C(C)CCC)n1)c1ccccc1C(=COC)C(=O)O |
| InChI | InChI=1S/C20H23NO3S/c1-5-8-13(2)19-21-18(12-25-19)14(3)15-9-6-7-10-16(15)17(11-24-4)20(22)23/h6-7,9-13H,3,5,8H2,1-2,4H3,(H,22,23) |
| InChIKey | OTDUKKBBEDABKF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|