C23H26N2O5 — CID 173285524
2-[2-[C-(cyclopropylmethoxy)-N-(3-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 173285524) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[2-[C-(cyclopropylmethoxy)-N-(3-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-[C-(cyclopropylmethoxy)-N-(3-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173285524 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[2-[C-(cyclopropylmethoxy)-N-(3-pyridin-2-ylpropoxy)carbonimidoyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | COC=C(C(=O)O)c1ccccc1C(=NOCCCc1ccccn1)OCC1CC1 |
| InChI | InChI=1S/C23H26N2O5/c1-28-16-21(23(26)27)19-9-2-3-10-20(19)22(29-15-17-11-12-17)25-30-14-6-8-18-7-4-5-13-24-18/h2-5,7,9-10,13,16-17H,6,8,11-12,14-15H2,1H3,(H,26,27) |
| InChIKey | DASBHIUIGZWYKM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|