C22H28N2O5 — CID 143865612
cyclohexylmethyl N-phenyl-N-pyridin-2-ylcarbamate;2-methoxyacetic acid (PubChem CID 143865612) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is cyclohexylmethyl N-phenyl-N-pyridin-2-ylcarbamate;2-methoxyacetic acid.
| Compound Name | cyclohexylmethyl N-phenyl-N-pyridin-2-ylcarbamate;2-methoxyacetic acid |
|---|---|
| PubChem CID | 143865612 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | cyclohexylmethyl N-phenyl-N-pyridin-2-ylcarbamate;2-methoxyacetic acid |
| SMILES | COCC(=O)O.O=C(OCC1CCCCC1)N(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H22N2O2.C3H6O3/c22-19(23-15-16-9-3-1-4-10-16)21(17-11-5-2-6-12-17)18-13-7-8-14-20-18;1-6-2-3(4)5/h2,5-8,11-14,16H,1,3-4,9-10,15H2;2H2,1H3,(H,4,5) |
| InChIKey | OIYHVYZPOYOOOJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |