C23H29FN2O4 — CID 143865610
3-(cyclohexylmethyl)-1-(3-fluorophenyl)-1-phenylurea;2-methoxyacetic acid (PubChem CID 143865610) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1-(3-fluorophenyl)-1-phenylurea;2-methoxyacetic acid.
| Compound Name | 3-(cyclohexylmethyl)-1-(3-fluorophenyl)-1-phenylurea;2-methoxyacetic acid |
|---|---|
| PubChem CID | 143865610 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-(cyclohexylmethyl)-1-(3-fluorophenyl)-1-phenylurea;2-methoxyacetic acid |
| SMILES | COCC(=O)O.O=C(NCC1CCCCC1)N(c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H23FN2O.C3H6O3/c21-17-10-7-13-19(14-17)23(18-11-5-2-6-12-18)20(24)22-15-16-8-3-1-4-9-16;1-6-2-3(4)5/h2,5-7,10-14,16H,1,3-4,8-9,15H2,(H,22,24);2H2,1H3,(H,4,5) |
| InChIKey | XWMCUPBVRPHBGY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |