C16H22FNO3S — CID 124509791
(2S)-N-(cyclohexylmethyl)-2-(3-fluorophenyl)sulfonylpropanamide (PubChem CID 124509791) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S)-N-(cyclohexylmethyl)-2-(3-fluorophenyl)sulfonylpropanamide.
| Compound Name | (2S)-N-(cyclohexylmethyl)-2-(3-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 124509791 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-N-(cyclohexylmethyl)-2-(3-fluorophenyl)sulfonylpropanamide |
| SMILES | C[C@@H](C(=O)NCC1CCCCC1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO3S/c1-12(16(19)18-11-13-6-3-2-4-7-13)22(20,21)15-9-5-8-14(17)10-15/h5,8-10,12-13H,2-4,6-7,11H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | UQOJYDGNHBNJES-LBPRGKRZSA-N |
| XLogP | 2.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |