C22H25F2N3O4S — CID 51134754
1-(3-fluorophenyl)-3-[[1-[2-(4-fluorophenyl)sulfonylpropanoyl]piperidin-3-yl]methyl]urea (PubChem CID 51134754) has the molecular formula C22H25F2N3O4S and a molecular weight of 465.52 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[1-[2-(4-fluorophenyl)sulfonylpropanoyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[1-[2-(4-fluorophenyl)sulfonylpropanoyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 51134754 |
| Molecular Formula | C22H25F2N3O4S |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[1-[2-(4-fluorophenyl)sulfonylpropanoyl]piperidin-3-yl]methyl]urea |
| SMILES | CC(C(=O)N1CCCC(CNC(=O)Nc2cccc(F)c2)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25F2N3O4S/c1-15(32(30,31)20-9-7-17(23)8-10-20)21(28)27-11-3-4-16(14-27)13-25-22(29)26-19-6-2-5-18(24)12-19/h2,5-10,12,15-16H,3-4,11,13-14H2,1H3,(H2,25,26,29) |
| InChIKey | JOBSWZQVUWMSNX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |