C17H26ClFN4O2 — CID 119761814
1-[[1-(3-aminobutanoyl)piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea;hydrochloride (PubChem CID 119761814) has the molecular formula C17H26ClFN4O2 and a molecular weight of 372.87 g/mol. Its IUPAC name is 1-[[1-(3-aminobutanoyl)piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea;hydrochloride.
| Compound Name | 1-[[1-(3-aminobutanoyl)piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119761814 |
| Molecular Formula | C17H26ClFN4O2 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[[1-(3-aminobutanoyl)piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea;hydrochloride |
| SMILES | CC(N)CC(=O)N1CCCC(CNC(=O)Nc2cccc(F)c2)C1.Cl |
| InChI | InChI=1S/C17H25FN4O2.ClH/c1-12(19)8-16(23)22-7-3-4-13(11-22)10-20-17(24)21-15-6-2-5-14(18)9-15;/h2,5-6,9,12-13H,3-4,7-8,10-11,19H2,1H3,(H2,20,21,24);1H |
| InChIKey | WOHLGLVEGQAZTR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |