C16H23FN4O2 — CID 95144992
(2R)-2-[(3R)-3-[[(3-fluorophenyl)carbamoylamino]methyl]piperidin-1-yl]propanamide (PubChem CID 95144992) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is (2R)-2-[(3R)-3-[[(3-fluorophenyl)carbamoylamino]methyl]piperidin-1-yl]propanamide.
| Compound Name | (2R)-2-[(3R)-3-[[(3-fluorophenyl)carbamoylamino]methyl]piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 95144992 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2R)-2-[(3R)-3-[[(3-fluorophenyl)carbamoylamino]methyl]piperidin-1-yl]propanamide |
| SMILES | C[C@H](C(N)=O)N1CCC[C@H](CNC(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H23FN4O2/c1-11(15(18)22)21-7-3-4-12(10-21)9-19-16(23)20-14-6-2-5-13(17)8-14/h2,5-6,8,11-12H,3-4,7,9-10H2,1H3,(H2,18,22)(H2,19,20,23)/t11-,12-/m1/s1 |
| InChIKey | SUFLPEYGMNFZMA-VXGBXAGGSA-N |
| XLogP | 1.53 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |