C20H32N4O — CID 95150446
1-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-3-(3-pyrrolidin-1-ylphenyl)urea (PubChem CID 95150446) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-3-(3-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-3-(3-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 95150446 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-3-(3-pyrrolidin-1-ylphenyl)urea |
| SMILES | CC(C)N1CCC[C@@H](CNC(=O)Nc2cccc(N3CCCC3)c2)C1 |
| InChI | InChI=1S/C20H32N4O/c1-16(2)24-12-6-7-17(15-24)14-21-20(25)22-18-8-5-9-19(13-18)23-10-3-4-11-23/h5,8-9,13,16-17H,3-4,6-7,10-12,14-15H2,1-2H3,(H2,21,22,25)/t17-/m0/s1 |
| InChIKey | NYLZRRZGTQSYED-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |