C18H28N4O2 — CID 167749594
1-(3-morpholin-4-ylphenyl)-3-(1-propan-2-ylpyrrolidin-3-yl)urea (PubChem CID 167749594) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylphenyl)-3-(1-propan-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(3-morpholin-4-ylphenyl)-3-(1-propan-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 167749594 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-(3-morpholin-4-ylphenyl)-3-(1-propan-2-ylpyrrolidin-3-yl)urea |
| SMILES | CC(C)N1CCC(NC(=O)Nc2cccc(N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C18H28N4O2/c1-14(2)22-7-6-16(13-22)20-18(23)19-15-4-3-5-17(12-15)21-8-10-24-11-9-21/h3-5,12,14,16H,6-11,13H2,1-2H3,(H2,19,20,23) |
| InChIKey | DLPZSGAYUGKMOY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |