C19H25N3O3 — CID 95130030
1-[(1S)-1-(2,5-dimethylfuran-3-yl)ethyl]-3-(3-morpholin-4-ylphenyl)urea (PubChem CID 95130030) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[(1S)-1-(2,5-dimethylfuran-3-yl)ethyl]-3-(3-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[(1S)-1-(2,5-dimethylfuran-3-yl)ethyl]-3-(3-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 95130030 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[(1S)-1-(2,5-dimethylfuran-3-yl)ethyl]-3-(3-morpholin-4-ylphenyl)urea |
| SMILES | Cc1cc([C@H](C)NC(=O)Nc2cccc(N3CCOCC3)c2)c(C)o1 |
| InChI | InChI=1S/C19H25N3O3/c1-13-11-18(15(3)25-13)14(2)20-19(23)21-16-5-4-6-17(12-16)22-7-9-24-10-8-22/h4-6,11-12,14H,7-10H2,1-3H3,(H2,20,21,23)/t14-/m0/s1 |
| InChIKey | NPFBNQKDKDIXPU-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |