C24H23F2N3O3 — CID 56503675
1-(3-fluorophenyl)-3-[[1-[5-(4-fluorophenyl)furan-2-carbonyl]piperidin-3-yl]methyl]urea (PubChem CID 56503675) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[1-[5-(4-fluorophenyl)furan-2-carbonyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[1-[5-(4-fluorophenyl)furan-2-carbonyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 56503675 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[1-[5-(4-fluorophenyl)furan-2-carbonyl]piperidin-3-yl]methyl]urea |
| SMILES | O=C(NCC1CCCN(C(=O)c2ccc(-c3ccc(F)cc3)o2)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H23F2N3O3/c25-18-8-6-17(7-9-18)21-10-11-22(32-21)23(30)29-12-2-3-16(15-29)14-27-24(31)28-20-5-1-4-19(26)13-20/h1,4-11,13,16H,2-3,12,14-15H2,(H2,27,28,31) |
| InChIKey | UUCWSYXTKXRSQM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |