C23H26F3N3O3 — CID 56504321
1-[[1-[4-(2,4-difluorophenoxy)butanoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea (PubChem CID 56504321) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is 1-[[1-[4-(2,4-difluorophenoxy)butanoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[[1-[4-(2,4-difluorophenoxy)butanoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 56504321 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[[1-[4-(2,4-difluorophenoxy)butanoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(NCC1CCCN(C(=O)CCCOc2ccc(F)cc2F)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H26F3N3O3/c24-17-5-1-6-19(12-17)28-23(31)27-14-16-4-2-10-29(15-16)22(30)7-3-11-32-21-9-8-18(25)13-20(21)26/h1,5-6,8-9,12-13,16H,2-4,7,10-11,14-15H2,(H2,27,28,31) |
| InChIKey | QKIBMYRSTLMMNO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|