C16H22F2N2O2 — CID 124612549
4-(2,4-difluorophenoxy)-1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one (PubChem CID 124612549) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-difluorophenoxy)-1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 124612549 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CNC[C@H]1CCN(C(=O)CCCOc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-19-10-12-6-7-20(11-12)16(21)3-2-8-22-15-5-4-13(17)9-14(15)18/h4-5,9,12,19H,2-3,6-8,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | KFCCYDCPIFKMDC-GFCCVEGCSA-N |
| XLogP | 2.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|