C22H22F3N3O2 — CID 56509303
1-[[1-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea (PubChem CID 56509303) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-[[1-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[[1-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 56509303 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[[1-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]piperidin-3-yl]methyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(NCC1CCCN(C(=O)/C=C/c2c(F)cccc2F)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H22F3N3O2/c23-16-5-1-6-17(12-16)27-22(30)26-13-15-4-3-11-28(14-15)21(29)10-9-18-19(24)7-2-8-20(18)25/h1-2,5-10,12,15H,3-4,11,13-14H2,(H2,26,27,30)/b10-9+ |
| InChIKey | DTKBBVGRKAUGBO-MDZDMXLPSA-N |
| XLogP | 4.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|