cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate

C21H25NO3 — CID 143865566

IUPACcyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate
SMILESCOc1cccc(N(C(=O)OCC2CCCCC2)c2ccccc2)c1
InChIInChI=1S/C21H25NO3/c1-24-20-14-8-13-19(15-20)22(18-11-6-3-7-12-18)21(23)25-16-17-9-4-2-5-10-17/h3,6-8,11-15,17H,2,4-5,9-10,16H2,1H3
InChIKeyIEAUOGIMKUHPIF-UHFFFAOYSA-N
MW339.44 g/mol
LogP5.55
Rot. Bonds5

About cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate

cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate (PubChem CID 143865566) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate.

Molecular Properties

Compound Namecyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate
PubChem CID143865566
Molecular FormulaC21H25NO3
Molecular Weight339.44 g/mol
Exact Mass339.18
IUPAC Namecyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate
SMILESCOc1cccc(N(C(=O)OCC2CCCCC2)c2ccccc2)c1
InChIInChI=1S/C21H25NO3/c1-24-20-14-8-13-19(15-20)22(18-11-6-3-7-12-18)21(23)25-16-17-9-4-2-5-10-17/h3,6-8,11-15,17H,2,4-5,9-10,16H2,1H3
InChIKeyIEAUOGIMKUHPIF-UHFFFAOYSA-N
XLogP5.55
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500339.44
LogP ≤ 55.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate?
The IUPAC name of cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate (CID 143865566) is cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate.
What is the SMILES notation for cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate?
The canonical SMILES for cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate is COc1cccc(N(C(=O)OCC2CCCCC2)c2ccccc2)c1.
What is the InChIKey of cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate?
The InChIKey is IEAUOGIMKUHPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-24-20-14-8-13-19(15-20)22(18-11-6-3-7-12-18)21(23)25-16-17-9-4-2-5-10-17/h3,6-8,11-15,17H,2,4-5,9-10,16H2,1H3.
What are the key properties of cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate?
cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate has a molecular weight of 339.44 g/mol, XLogP of 5.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl N-(3-methoxyphenyl)-N-phenylcarbamate is sourced from PubChem (CID 143865566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).