About benzoic acid;methoxymethylcyclohexane
benzoic acid;methoxymethylcyclohexane (PubChem CID 175415905) has the molecular formula C22H28O5
and a molecular weight of 372.46 g/mol. Its IUPAC name is benzoic acid;methoxymethylcyclohexane.
Molecular Properties
| Compound Name | benzoic acid;methoxymethylcyclohexane |
| PubChem CID | 175415905 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | benzoic acid;methoxymethylcyclohexane |
| SMILES | COCC1CCCCC1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H16O.2C7H6O2/c1-9-7-8-5-3-2-4-6-8;2*8-7(9)6-4-2-1-3-5-6/h8H,2-7H2,1H3;2*1-5H,(H,8,9) |
| InChIKey | HXBVLGWAUZSWBX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;methoxymethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;methoxymethylcyclohexane?
The IUPAC name of benzoic acid;methoxymethylcyclohexane (CID 175415905) is benzoic acid;methoxymethylcyclohexane.
What is the SMILES notation for benzoic acid;methoxymethylcyclohexane?
The canonical SMILES for benzoic acid;methoxymethylcyclohexane is COCC1CCCCC1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;methoxymethylcyclohexane?
The InChIKey is HXBVLGWAUZSWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.2C7H6O2/c1-9-7-8-5-3-2-4-6-8;2*8-7(9)6-4-2-1-3-5-6/h8H,2-7H2,1H3;2*1-5H,(H,8,9).
What are the key properties of benzoic acid;methoxymethylcyclohexane?
benzoic acid;methoxymethylcyclohexane has a molecular weight of 372.46 g/mol, XLogP of 4.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;methoxymethylcyclohexane is sourced from PubChem (CID 175415905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).