C17H23NO3 — CID 121091399
1-[4-(methoxymethyl)piperidin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 121091399) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)piperidin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[4-(methoxymethyl)piperidin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 121091399 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[4-(methoxymethyl)piperidin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | COCC1CCN(C(=O)CCC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H23NO3/c1-21-13-14-9-11-18(12-10-14)17(20)8-7-16(19)15-5-3-2-4-6-15/h2-6,14H,7-13H2,1H3 |
| InChIKey | HHMGEEQRPVDXBX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |