C23H29ClN2O4 — CID 169189359
cyclohexylmethyl N-(4-chlorophenyl)-N-phenylcarbamate;2-methoxyacetamide (PubChem CID 169189359) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is cyclohexylmethyl N-(4-chlorophenyl)-N-phenylcarbamate;2-methoxyacetamide.
| Compound Name | cyclohexylmethyl N-(4-chlorophenyl)-N-phenylcarbamate;2-methoxyacetamide |
|---|---|
| PubChem CID | 169189359 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | cyclohexylmethyl N-(4-chlorophenyl)-N-phenylcarbamate;2-methoxyacetamide |
| SMILES | COCC(N)=O.O=C(OCC1CCCCC1)N(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO2.C3H7NO2/c21-17-11-13-19(14-12-17)22(18-9-5-2-6-10-18)20(23)24-15-16-7-3-1-4-8-16;1-6-2-3(4)5/h2,5-6,9-14,16H,1,3-4,7-8,15H2;2H2,1H3,(H2,4,5) |
| InChIKey | GYIWHLDOYMKYLD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |