C31H43ClN6O8S — CID 88876922
2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethylsulfonyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 88876922) has the molecular formula C31H43ClN6O8S and a molecular weight of 695.24 g/mol. Its IUPAC name is 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethylsulfonyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethylsulfonyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 88876922 |
| Molecular Formula | C31H43ClN6O8S |
| Molecular Weight | 695.24 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethylsulfonyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)OS(=O)(=O)CCNC(=O)COCC1CCC(COC(=O)N(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C31H43ClN6O8S/c32-24-12-14-26(15-13-24)38(25-5-2-1-3-6-25)31(41)45-20-23-10-8-22(9-11-23)19-44-21-28(39)36-17-18-47(42,43)46-29(40)27(33)7-4-16-37-30(34)35/h1-3,5-6,12-15,22-23,27H,4,7-11,16-21,33H2,(H,36,39)(H4,34,35,37)/t22?,23?,27-/m0/s1 |
| InChIKey | VHXXAZUPIYNPJZ-GMKWRKAISA-N |
| XLogP | 2.81 |
| TPSA | 218.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|