C22H27ClN6O3 — CID 70559434
(2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 70559434) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 70559434 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CN(CC(=O)NC(=O)[C@@H](N)CCCN=C(N)N)c1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN6O3/c1-29(13-19(30)28-21(32)17(24)8-5-11-27-22(25)26)18-10-9-15(23)12-16(18)20(31)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17H,5,8,11,13,24H2,1H3,(H4,25,26,27)(H,28,30,32)/t17-/m0/s1 |
| InChIKey | CUQGEVONNDDYFU-KRWDZBQOSA-N |
| XLogP | 1.03 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|