C23H26ClN3O7 — CID 90475753
(2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-3-methylbutanamide;oxalic acid (PubChem CID 90475753) has the molecular formula C23H26ClN3O7 and a molecular weight of 491.93 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-3-methylbutanamide;oxalic acid.
| Compound Name | (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-3-methylbutanamide;oxalic acid |
|---|---|
| PubChem CID | 90475753 |
| Molecular Formula | C23H26ClN3O7 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-benzoyl-4-chloro-N-methylanilino)acetyl]-3-methylbutanamide;oxalic acid |
| SMILES | CC(C)[C@H](N)C(=O)NC(=O)CN(C)c1ccc(Cl)cc1C(=O)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H24ClN3O3.C2H2O4/c1-13(2)19(23)21(28)24-18(26)12-25(3)17-10-9-15(22)11-16(17)20(27)14-7-5-4-6-8-14;3-1(4)2(5)6/h4-11,13,19H,12,23H2,1-3H3,(H,24,26,28);(H,3,4)(H,5,6)/t19-;/m0./s1 |
| InChIKey | NQYJTHHBRYIINV-FYZYNONXSA-N |
| XLogP | 1.79 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|