C25H33ClN2O8S — CID 88876702
2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethanesulfonic acid;hydrate (PubChem CID 88876702) has the molecular formula C25H33ClN2O8S and a molecular weight of 557.07 g/mol. Its IUPAC name is 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethanesulfonic acid;hydrate.
| Compound Name | 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 88876702 |
| Molecular Formula | C25H33ClN2O8S |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 2-[[2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetyl]amino]ethanesulfonic acid;hydrate |
| SMILES | O.O=C(COCC1CCC(COC(=O)N(c2ccccc2)c2ccc(Cl)cc2)CC1)NCCS(=O)(=O)O |
| InChI | InChI=1S/C25H31ClN2O7S.H2O/c26-21-10-12-23(13-11-21)28(22-4-2-1-3-5-22)25(30)35-17-20-8-6-19(7-9-20)16-34-18-24(29)27-14-15-36(31,32)33;/h1-5,10-13,19-20H,6-9,14-18H2,(H,27,29)(H,31,32,33);1H2 |
| InChIKey | ADJVBJXOGOWLFC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|