C20H22ClNO3 — CID 143865656
cyclohexylmethyl N-(4-chlorophenyl)-N-(4-hydroxyphenyl)carbamate (PubChem CID 143865656) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is cyclohexylmethyl N-(4-chlorophenyl)-N-(4-hydroxyphenyl)carbamate.
| Compound Name | cyclohexylmethyl N-(4-chlorophenyl)-N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 143865656 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | cyclohexylmethyl N-(4-chlorophenyl)-N-(4-hydroxyphenyl)carbamate |
| SMILES | O=C(OCC1CCCCC1)N(c1ccc(O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO3/c21-16-6-8-17(9-7-16)22(18-10-12-19(23)13-11-18)20(24)25-14-15-4-2-1-3-5-15/h6-13,15,23H,1-5,14H2 |
| InChIKey | MTVALLBJBLSZIJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |