C26H32ClNO5 — CID 170655002
propyl 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetate (PubChem CID 170655002) has the molecular formula C26H32ClNO5 and a molecular weight of 474.00 g/mol. Its IUPAC name is propyl 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetate.
| Compound Name | propyl 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetate |
|---|---|
| PubChem CID | 170655002 |
| Molecular Formula | C26H32ClNO5 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | propyl 2-[[4-[[(4-chlorophenyl)-phenylcarbamoyl]oxymethyl]cyclohexyl]methoxy]acetate |
| SMILES | CCCOC(=O)COCC1CCC(COC(=O)N(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H32ClNO5/c1-2-16-32-25(29)19-31-17-20-8-10-21(11-9-20)18-33-26(30)28(23-6-4-3-5-7-23)24-14-12-22(27)13-15-24/h3-7,12-15,20-21H,2,8-11,16-19H2,1H3 |
| InChIKey | VJAVYXNTTBLSJX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |