About 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea
1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea (PubChem CID 86237214) has the molecular formula C17H19ClN2O
and a molecular weight of 302.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea |
| PubChem CID | 86237214 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea |
| SMILES | CCN(CC)C(=O)N(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O/c1-3-19(4-2)17(21)20(15-8-6-5-7-9-15)16-12-10-14(18)11-13-16/h5-13H,3-4H2,1-2H3 |
| InChIKey | KZQAWJNRULKDHX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea?
The IUPAC name of 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea (CID 86237214) is 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea.
What is the SMILES notation for 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea?
The canonical SMILES for 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea is CCN(CC)C(=O)N(c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea?
The InChIKey is KZQAWJNRULKDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O/c1-3-19(4-2)17(21)20(15-8-6-5-7-9-15)16-12-10-14(18)11-13-16/h5-13H,3-4H2,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea?
1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea has a molecular weight of 302.81 g/mol, XLogP of 4.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3,3-diethyl-1-phenylurea is sourced from PubChem (CID 86237214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).