C20H24N2O3 — CID 51362044
N,N-diethyl-2-[2-oxo-2-(N-phenylanilino)ethoxy]acetamide (PubChem CID 51362044) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N,N-diethyl-2-[2-oxo-2-(N-phenylanilino)ethoxy]acetamide.
| Compound Name | N,N-diethyl-2-[2-oxo-2-(N-phenylanilino)ethoxy]acetamide |
|---|---|
| PubChem CID | 51362044 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N,N-diethyl-2-[2-oxo-2-(N-phenylanilino)ethoxy]acetamide |
| SMILES | CCN(CC)C(=O)COCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-3-21(4-2)19(23)15-25-16-20(24)22(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | CIXDCABMARQDRB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |