C16H18N2O2 — CID 23183847
1-ethyl-1-(hydroxymethyl)-3,3-diphenylurea (PubChem CID 23183847) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-ethyl-1-(hydroxymethyl)-3,3-diphenylurea.
| Compound Name | 1-ethyl-1-(hydroxymethyl)-3,3-diphenylurea |
|---|---|
| PubChem CID | 23183847 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-ethyl-1-(hydroxymethyl)-3,3-diphenylurea |
| SMILES | CCN(CO)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c1-2-17(13-19)16(20)18(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,19H,2,13H2,1H3 |
| InChIKey | DVMNAINZBXDYRG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|