C19H24N2O — CID 109005016
2-(N-benzylanilino)-N,N-diethylacetamide (PubChem CID 109005016) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-(N-benzylanilino)-N,N-diethylacetamide.
| Compound Name | 2-(N-benzylanilino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 109005016 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(N-benzylanilino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-3-20(4-2)19(22)16-21(18-13-9-6-10-14-18)15-17-11-7-5-8-12-17/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | YZDLJKVCMGIZAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |