C20H26N2O — CID 109030661
3-(N-benzylanilino)-N,N-diethylpropanamide (PubChem CID 109030661) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(N-benzylanilino)-N,N-diethylpropanamide.
| Compound Name | 3-(N-benzylanilino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 109030661 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-(N-benzylanilino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-3-21(4-2)20(23)15-16-22(19-13-9-6-10-14-19)17-18-11-7-5-8-12-18/h5-14H,3-4,15-17H2,1-2H3 |
| InChIKey | YLDSTSUAQQWILF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |